Depsides and depsidones
Apexbio Technology LLC Emamectin Benzoate 155569-91-8 500mg
Emamectin Benzoate (CAS 155569-91-8) is a semi-synthetic derivative targeting insect -aminobutyric acid (GABA) receptors It is designed to interact with these receptors thereby disrupting neurosignaling function Emamectin Benzoate exerts its biological activity primarily through receptor binding that impairs neuronal signaling elevates reactive oxygen species (ROS) production and induces DNA oxidative damage followed by cellular apoptosis In vitro studies have revealed IC50 values typically ranging from low nanomolar to micromolar concentrations depending on insect cell lines and experimental conditions Based on these pharmacological properties Emamectin Benzoate holds research potential in neuroscience toxicology oxidative stress assessments and studies of programmed cell death
eMolecules 530-75-6 | Acetylsalicylsalicylic acid | Combi-Blocks | MFCD00143537 | 300.266 | C16H12O6 | 97.000 | CC(=O)Oc1ccccc1C(=O)Oc1ccccc1C(O)=O | 1g | 388719560
Acetylsalicylsalicylic acid | Combi-Blocks | 530-75-6 | MFCD00143537 | 300.266 | C16H12O6 | 97.000 | CC(=O)Oc1ccccc1C(=O)Oc1ccccc1C(O)=O | 1g | 388719560
Medchemexpress LLC Sodium benzoate | 532-32-1 | MFCD00012463 | ≥98.0% | 25g
Sodium benzoate is an orally active pharmaceutical excipient such as an antibacterial agent preservative lubricant etc Pharmaceutical excipients or pharmaceutical auxiliaries refer to other chemical substances used in the pharmaceutical process other than pharmaceutical ingredients Pharmaceutical excipients generally refer to inactive ingredients in pharmaceutical preparations which can improve the stability solubility and processability of pharmaceutical preparations Pharmaceutical excipients also affect the absorption distribution metabolism and elimination (ADME) processes of co-administered drugs Sodium benzoate activates NF- B and induces Apoptosis Sodium benzoate induces immune suppression and produces reproductively toxic Sodium benzoate can be used for colon cancer and immune disease research[1][2][3][4][5]